C12H13BrN4S — CID 107277676
2-bromo-4-[(1-methylpyrazol-4-yl)methylamino]benzenecarbothioamide (PubChem CID 107277676) has the molecular formula C12H13BrN4S and a molecular weight of 325.24 g/mol. Its IUPAC name is 2-bromo-4-[(1-methylpyrazol-4-yl)methylamino]benzenecarbothioamide.
| Compound Name | 2-bromo-4-[(1-methylpyrazol-4-yl)methylamino]benzenecarbothioamide |
|---|---|
| PubChem CID | 107277676 |
| Molecular Formula | C12H13BrN4S |
| Molecular Weight | 325.24 g/mol |
| Exact Mass | 324.00 |
| IUPAC Name | 2-bromo-4-[(1-methylpyrazol-4-yl)methylamino]benzenecarbothioamide |
| SMILES | Cn1cc(CNc2ccc(C(N)=S)c(Br)c2)cn1 |
| InChI | InChI=1S/C12H13BrN4S/c1-17-7-8(6-16-17)5-15-9-2-3-10(12(14)18)11(13)4-9/h2-4,6-7,15H,5H2,1H3,(H2,14,18) |
| InChIKey | QWNHVAPHPJOIKK-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.24 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|