C13H15BrN4S — CID 107278051
2-bromo-4-[(1,3-dimethylpyrazol-4-yl)methylamino]benzenecarbothioamide (PubChem CID 107278051) has the molecular formula C13H15BrN4S and a molecular weight of 339.26 g/mol. Its IUPAC name is 2-bromo-4-[(1,3-dimethylpyrazol-4-yl)methylamino]benzenecarbothioamide.
| Compound Name | 2-bromo-4-[(1,3-dimethylpyrazol-4-yl)methylamino]benzenecarbothioamide |
|---|---|
| PubChem CID | 107278051 |
| Molecular Formula | C13H15BrN4S |
| Molecular Weight | 339.26 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | 2-bromo-4-[(1,3-dimethylpyrazol-4-yl)methylamino]benzenecarbothioamide |
| SMILES | Cc1nn(C)cc1CNc1ccc(C(N)=S)c(Br)c1 |
| InChI | InChI=1S/C13H15BrN4S/c1-8-9(7-18(2)17-8)6-16-10-3-4-11(13(15)19)12(14)5-10/h3-5,7,16H,6H2,1-2H3,(H2,15,19) |
| InChIKey | NJYGMOLJTRDBPN-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.26 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|