C13H15ClN4O — CID 83086550
2-chloro-5-[(1,3-dimethylpyrazol-4-yl)methylamino]benzamide (PubChem CID 83086550) has the molecular formula C13H15ClN4O and a molecular weight of 278.74 g/mol. Its IUPAC name is 2-chloro-5-[(1,3-dimethylpyrazol-4-yl)methylamino]benzamide.
| Compound Name | 2-chloro-5-[(1,3-dimethylpyrazol-4-yl)methylamino]benzamide |
|---|---|
| PubChem CID | 83086550 |
| Molecular Formula | C13H15ClN4O |
| Molecular Weight | 278.74 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 2-chloro-5-[(1,3-dimethylpyrazol-4-yl)methylamino]benzamide |
| SMILES | Cc1nn(C)cc1CNc1ccc(Cl)c(C(N)=O)c1 |
| InChI | InChI=1S/C13H15ClN4O/c1-8-9(7-18(2)17-8)6-16-10-3-4-12(14)11(5-10)13(15)19/h3-5,7,16H,6H2,1-2H3,(H2,15,19) |
| InChIKey | RZJBNRQTJJRSFG-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.74 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |