C14H15N5O2 — CID 83090137
6-[(1,3-dimethylpyrazol-4-yl)methylamino]-1,4-dihydroquinoxaline-2,3-dione (PubChem CID 83090137) has the molecular formula C14H15N5O2 and a molecular weight of 285.31 g/mol. Its IUPAC name is 6-[(1,3-dimethylpyrazol-4-yl)methylamino]-1,4-dihydroquinoxaline-2,3-dione.
| Compound Name | 6-[(1,3-dimethylpyrazol-4-yl)methylamino]-1,4-dihydroquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 83090137 |
| Molecular Formula | C14H15N5O2 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 6-[(1,3-dimethylpyrazol-4-yl)methylamino]-1,4-dihydroquinoxaline-2,3-dione |
| SMILES | Cc1nn(C)cc1CNc1ccc2[nH]c(=O)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C14H15N5O2/c1-8-9(7-19(2)18-8)6-15-10-3-4-11-12(5-10)17-14(21)13(20)16-11/h3-5,7,15H,6H2,1-2H3,(H,16,20)(H,17,21) |
| InChIKey | DPKRFONEAUBMMB-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 95.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|