C15H14N4O2 — CID 81307955
6-[(5-methyl-2-pyridinyl)methylamino]-1,4-dihydroquinoxaline-2,3-dione (PubChem CID 81307955) has the molecular formula C15H14N4O2 and a molecular weight of 282.30 g/mol. Its IUPAC name is 6-[(5-methyl-2-pyridinyl)methylamino]-1,4-dihydroquinoxaline-2,3-dione.
| Compound Name | 6-[(5-methyl-2-pyridinyl)methylamino]-1,4-dihydroquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 81307955 |
| Molecular Formula | C15H14N4O2 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 6-[(5-methyl-2-pyridinyl)methylamino]-1,4-dihydroquinoxaline-2,3-dione |
| SMILES | Cc1ccc(CNc2ccc3[nH]c(=O)c(=O)[nH]c3c2)nc1 |
| InChI | InChI=1S/C15H14N4O2/c1-9-2-3-11(16-7-9)8-17-10-4-5-12-13(6-10)19-15(21)14(20)18-12/h2-7,17H,8H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | BPFNXJVCMKBYJL-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 90.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|