C16H21N5 — CID 43791200
2-methyl-N-[(1-methyl-3-propan-2-ylpyrazol-4-yl)methyl]-3H-benzimidazol-5-amine (PubChem CID 43791200) has the molecular formula C16H21N5 and a molecular weight of 283.38 g/mol. Its IUPAC name is 2-methyl-N-[(1-methyl-3-propan-2-ylpyrazol-4-yl)methyl]-3H-benzimidazol-5-amine.
| Compound Name | 2-methyl-N-[(1-methyl-3-propan-2-ylpyrazol-4-yl)methyl]-3H-benzimidazol-5-amine |
|---|---|
| PubChem CID | 43791200 |
| Molecular Formula | C16H21N5 |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | 2-methyl-N-[(1-methyl-3-propan-2-ylpyrazol-4-yl)methyl]-3H-benzimidazol-5-amine |
| SMILES | Cc1nc2ccc(NCc3cn(C)nc3C(C)C)cc2[nH]1 |
| InChI | InChI=1S/C16H21N5/c1-10(2)16-12(9-21(4)20-16)8-17-13-5-6-14-15(7-13)19-11(3)18-14/h5-7,9-10,17H,8H2,1-4H3,(H,18,19) |
| InChIKey | ZNWFTAZFGYKMMG-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |