C16H16FN3 — CID 103818702
N-[(2-fluoro-5-methylphenyl)methyl]-2-methyl-3H-benzimidazol-5-amine (PubChem CID 103818702) has the molecular formula C16H16FN3 and a molecular weight of 269.32 g/mol. Its IUPAC name is N-[(2-fluoro-5-methylphenyl)methyl]-2-methyl-3H-benzimidazol-5-amine.
| Compound Name | N-[(2-fluoro-5-methylphenyl)methyl]-2-methyl-3H-benzimidazol-5-amine |
|---|---|
| PubChem CID | 103818702 |
| Molecular Formula | C16H16FN3 |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | N-[(2-fluoro-5-methylphenyl)methyl]-2-methyl-3H-benzimidazol-5-amine |
| SMILES | Cc1ccc(F)c(CNc2ccc3nc(C)[nH]c3c2)c1 |
| InChI | InChI=1S/C16H16FN3/c1-10-3-5-14(17)12(7-10)9-18-13-4-6-15-16(8-13)20-11(2)19-15/h3-8,18H,9H2,1-2H3,(H,19,20) |
| InChIKey | GOXCTTMQDFNFOL-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |