C12H12N4S — CID 62759070
2-methyl-N-(1,3-thiazol-5-ylmethyl)-3H-benzimidazol-5-amine (PubChem CID 62759070) has the molecular formula C12H12N4S and a molecular weight of 244.32 g/mol. Its IUPAC name is 2-methyl-N-(1,3-thiazol-5-ylmethyl)-3H-benzimidazol-5-amine.
| Compound Name | 2-methyl-N-(1,3-thiazol-5-ylmethyl)-3H-benzimidazol-5-amine |
|---|---|
| PubChem CID | 62759070 |
| Molecular Formula | C12H12N4S |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 2-methyl-N-(1,3-thiazol-5-ylmethyl)-3H-benzimidazol-5-amine |
| SMILES | Cc1nc2ccc(NCc3cncs3)cc2[nH]1 |
| InChI | InChI=1S/C12H12N4S/c1-8-15-11-3-2-9(4-12(11)16-8)14-6-10-5-13-7-17-10/h2-5,7,14H,6H2,1H3,(H,15,16) |
| InChIKey | BRSBJHSJFGOFED-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |