C11H10N4OS — CID 55110337
5-(1,3-thiazol-5-ylmethylamino)-1,3-dihydrobenzimidazol-2-one (PubChem CID 55110337) has the molecular formula C11H10N4OS and a molecular weight of 246.30 g/mol. Its IUPAC name is 5-(1,3-thiazol-5-ylmethylamino)-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-(1,3-thiazol-5-ylmethylamino)-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 55110337 |
| Molecular Formula | C11H10N4OS |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 5-(1,3-thiazol-5-ylmethylamino)-1,3-dihydrobenzimidazol-2-one |
| SMILES | O=c1[nH]c2ccc(NCc3cncs3)cc2[nH]1 |
| InChI | InChI=1S/C11H10N4OS/c16-11-14-9-2-1-7(3-10(9)15-11)13-5-8-4-12-6-17-8/h1-4,6,13H,5H2,(H2,14,15,16) |
| InChIKey | PMVUMQOYFIZJAD-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 73.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_A(5)', 'substructure': 'N/A'} |
|---|