C13H10ClN3O2S — CID 79419720
6-[(4-chlorothiophen-2-yl)methylamino]-1,4-dihydroquinoxaline-2,3-dione (PubChem CID 79419720) has the molecular formula C13H10ClN3O2S and a molecular weight of 307.76 g/mol. Its IUPAC name is 6-[(4-chlorothiophen-2-yl)methylamino]-1,4-dihydroquinoxaline-2,3-dione.
| Compound Name | 6-[(4-chlorothiophen-2-yl)methylamino]-1,4-dihydroquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 79419720 |
| Molecular Formula | C13H10ClN3O2S |
| Molecular Weight | 307.76 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | 6-[(4-chlorothiophen-2-yl)methylamino]-1,4-dihydroquinoxaline-2,3-dione |
| SMILES | O=c1[nH]c2ccc(NCc3cc(Cl)cs3)cc2[nH]c1=O |
| InChI | InChI=1S/C13H10ClN3O2S/c14-7-3-9(20-6-7)5-15-8-1-2-10-11(4-8)17-13(19)12(18)16-10/h1-4,6,15H,5H2,(H,16,18)(H,17,19) |
| InChIKey | XCKDKTVFPXIOPD-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.76 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|