C11H11ClN2S — CID 22486438
4-N-[(4-chlorothiophen-2-yl)methyl]benzene-1,4-diamine (PubChem CID 22486438) has the molecular formula C11H11ClN2S and a molecular weight of 238.74 g/mol. Its IUPAC name is 4-N-[(4-chlorothiophen-2-yl)methyl]benzene-1,4-diamine.
| Compound Name | 4-N-[(4-chlorothiophen-2-yl)methyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 22486438 |
| Molecular Formula | C11H11ClN2S |
| Molecular Weight | 238.74 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | 4-N-[(4-chlorothiophen-2-yl)methyl]benzene-1,4-diamine |
| SMILES | Nc1ccc(NCc2cc(Cl)cs2)cc1 |
| InChI | InChI=1S/C11H11ClN2S/c12-8-5-11(15-7-8)6-14-10-3-1-9(13)2-4-10/h1-5,7,14H,6,13H2 |
| InChIKey | ZZHFFAUATYUCRB-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.74 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|