C11H8ClF2NS — CID 79420302
N-[(4-chlorothiophen-2-yl)methyl]-2,6-difluoroaniline (PubChem CID 79420302) has the molecular formula C11H8ClF2NS and a molecular weight of 259.71 g/mol. Its IUPAC name is N-[(4-chlorothiophen-2-yl)methyl]-2,6-difluoroaniline.
| Compound Name | N-[(4-chlorothiophen-2-yl)methyl]-2,6-difluoroaniline |
|---|---|
| PubChem CID | 79420302 |
| Molecular Formula | C11H8ClF2NS |
| Molecular Weight | 259.71 g/mol |
| Exact Mass | 259.00 |
| IUPAC Name | N-[(4-chlorothiophen-2-yl)methyl]-2,6-difluoroaniline |
| SMILES | Fc1cccc(F)c1NCc1cc(Cl)cs1 |
| InChI | InChI=1S/C11H8ClF2NS/c12-7-4-8(16-6-7)5-15-11-9(13)2-1-3-10(11)14/h1-4,6,15H,5H2 |
| InChIKey | RXELKQSEQNJGAP-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.71 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |