C17H19N3O — CID 28622210
5-[(2,4,6-trimethylphenyl)methylamino]-1,3-dihydrobenzimidazol-2-one (PubChem CID 28622210) has the molecular formula C17H19N3O and a molecular weight of 281.36 g/mol. Its IUPAC name is 5-[(2,4,6-trimethylphenyl)methylamino]-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-[(2,4,6-trimethylphenyl)methylamino]-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 28622210 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 5-[(2,4,6-trimethylphenyl)methylamino]-1,3-dihydrobenzimidazol-2-one |
| SMILES | Cc1cc(C)c(CNc2ccc3[nH]c(=O)[nH]c3c2)c(C)c1 |
| InChI | InChI=1S/C17H19N3O/c1-10-6-11(2)14(12(3)7-10)9-18-13-4-5-15-16(8-13)20-17(21)19-15/h4-8,18H,9H2,1-3H3,(H2,19,20,21) |
| InChIKey | UMBYMSZGRHPGLC-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 60.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_A(5)', 'substructure': 'N/A'} |
|---|