C16H16BrN3O3 — CID 66543511
5-[(6-bromo-2,3-dimethoxyphenyl)methylamino]-1,3-dihydrobenzimidazol-2-one (PubChem CID 66543511) has the molecular formula C16H16BrN3O3 and a molecular weight of 378.23 g/mol. Its IUPAC name is 5-[(6-bromo-2,3-dimethoxyphenyl)methylamino]-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-[(6-bromo-2,3-dimethoxyphenyl)methylamino]-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 66543511 |
| Molecular Formula | C16H16BrN3O3 |
| Molecular Weight | 378.23 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | 5-[(6-bromo-2,3-dimethoxyphenyl)methylamino]-1,3-dihydrobenzimidazol-2-one |
| SMILES | COc1ccc(Br)c(CNc2ccc3[nH]c(=O)[nH]c3c2)c1OC |
| InChI | InChI=1S/C16H16BrN3O3/c1-22-14-6-4-11(17)10(15(14)23-2)8-18-9-3-5-12-13(7-9)20-16(21)19-12/h3-7,18H,8H2,1-2H3,(H2,19,20,21) |
| InChIKey | JPHPBDUNQRZBIQ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 79.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.23 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_A(5)', 'substructure': 'N/A'} |
|---|