C22H20ClN3O3 — CID 1143869
5-[[2-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methylamino]-1,3-dihydrobenzimidazol-2-one (PubChem CID 1143869) has the molecular formula C22H20ClN3O3 and a molecular weight of 409.87 g/mol. Its IUPAC name is 5-[[2-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methylamino]-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-[[2-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methylamino]-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 1143869 |
| Molecular Formula | C22H20ClN3O3 |
| Molecular Weight | 409.87 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 5-[[2-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methylamino]-1,3-dihydrobenzimidazol-2-one |
| SMILES | COc1cccc(CNc2ccc3[nH]c(=O)[nH]c3c2)c1OCc1ccccc1Cl |
| InChI | InChI=1S/C22H20ClN3O3/c1-28-20-8-4-6-14(21(20)29-13-15-5-2-3-7-17(15)23)12-24-16-9-10-18-19(11-16)26-22(27)25-18/h2-11,24H,12-13H2,1H3,(H2,25,26,27) |
| InChIKey | MYKBGMNNPCPVTR-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 79.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.87 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_A(5)', 'substructure': 'N/A'} |
|---|