C22H21ClFN3O3 — CID 17060210
5-[[2-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylamino]-1,3-dihydrobenzimidazol-2-one;hydrochloride (PubChem CID 17060210) has the molecular formula C22H21ClFN3O3 and a molecular weight of 429.88 g/mol. Its IUPAC name is 5-[[2-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylamino]-1,3-dihydrobenzimidazol-2-one;hydrochloride.
| Compound Name | 5-[[2-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylamino]-1,3-dihydrobenzimidazol-2-one;hydrochloride |
|---|---|
| PubChem CID | 17060210 |
| Molecular Formula | C22H21ClFN3O3 |
| Molecular Weight | 429.88 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | 5-[[2-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylamino]-1,3-dihydrobenzimidazol-2-one;hydrochloride |
| SMILES | COc1cccc(CNc2ccc3[nH]c(=O)[nH]c3c2)c1OCc1ccc(F)cc1.Cl |
| InChI | InChI=1S/C22H20FN3O3.ClH/c1-28-20-4-2-3-15(21(20)29-13-14-5-7-16(23)8-6-14)12-24-17-9-10-18-19(11-17)26-22(27)25-18;/h2-11,24H,12-13H2,1H3,(H2,25,26,27);1H |
| InChIKey | GRYSEENSRHBGBL-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 79.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.88 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_A(5)', 'substructure': 'N/A'} |
|---|