C22H20ClN3O3 — CID 73362904
5-[(3-methoxy-2-phenylmethoxyphenyl)methylamino]benzimidazol-2-one;hydrochloride (PubChem CID 73362904) has the molecular formula C22H20ClN3O3 and a molecular weight of 409.87 g/mol. Its IUPAC name is 5-[(3-methoxy-2-phenylmethoxyphenyl)methylamino]benzimidazol-2-one;hydrochloride.
| Compound Name | 5-[(3-methoxy-2-phenylmethoxyphenyl)methylamino]benzimidazol-2-one;hydrochloride |
|---|---|
| PubChem CID | 73362904 |
| Molecular Formula | C22H20ClN3O3 |
| Molecular Weight | 409.87 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 5-[(3-methoxy-2-phenylmethoxyphenyl)methylamino]benzimidazol-2-one;hydrochloride |
| SMILES | COc1cccc(CNc2ccc3c(c2)=NC(=O)N=3)c1OCc1ccccc1.Cl |
| InChI | InChI=1S/C22H19N3O3.ClH/c1-27-20-9-5-8-16(21(20)28-14-15-6-3-2-4-7-15)13-23-17-10-11-18-19(12-17)25-22(26)24-18;/h2-12,23H,13-14H2,1H3;1H |
| InChIKey | KVYBOQPMLLSULV-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.87 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |