C19H25ClFNO2 — CID 17291397
N-[[2-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]butan-2-amine;hydrochloride (PubChem CID 17291397) has the molecular formula C19H25ClFNO2 and a molecular weight of 353.87 g/mol. Its IUPAC name is N-[[2-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]butan-2-amine;hydrochloride.
| Compound Name | N-[[2-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]butan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 17291397 |
| Molecular Formula | C19H25ClFNO2 |
| Molecular Weight | 353.87 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | N-[[2-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]butan-2-amine;hydrochloride |
| SMILES | CCC(C)NCc1cccc(OC)c1OCc1ccc(F)cc1.Cl |
| InChI | InChI=1S/C19H24FNO2.ClH/c1-4-14(2)21-12-16-6-5-7-18(22-3)19(16)23-13-15-8-10-17(20)11-9-15;/h5-11,14,21H,4,12-13H2,1-3H3;1H |
| InChIKey | DUZATCTUKNOXKL-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.87 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |