C18H22BrClFNO — CID 17291422
N-[[5-bromo-2-[(4-fluorophenyl)methoxy]phenyl]methyl]butan-2-amine;hydrochloride (PubChem CID 17291422) has the molecular formula C18H22BrClFNO and a molecular weight of 402.74 g/mol. Its IUPAC name is N-[[5-bromo-2-[(4-fluorophenyl)methoxy]phenyl]methyl]butan-2-amine;hydrochloride.
| Compound Name | N-[[5-bromo-2-[(4-fluorophenyl)methoxy]phenyl]methyl]butan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 17291422 |
| Molecular Formula | C18H22BrClFNO |
| Molecular Weight | 402.74 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | N-[[5-bromo-2-[(4-fluorophenyl)methoxy]phenyl]methyl]butan-2-amine;hydrochloride |
| SMILES | CCC(C)NCc1cc(Br)ccc1OCc1ccc(F)cc1.Cl |
| InChI | InChI=1S/C18H21BrFNO.ClH/c1-3-13(2)21-11-15-10-16(19)6-9-18(15)22-12-14-4-7-17(20)8-5-14;/h4-10,13,21H,3,11-12H2,1-2H3;1H |
| InChIKey | VXHYIGGESQNZIH-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.74 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |