C16H18BrClFNO — CID 2983714
N-[(5-bromo-2-ethoxyphenyl)methyl]-1-(4-fluorophenyl)methanamine;hydrochloride (PubChem CID 2983714) has the molecular formula C16H18BrClFNO and a molecular weight of 374.68 g/mol. Its IUPAC name is N-[(5-bromo-2-ethoxyphenyl)methyl]-1-(4-fluorophenyl)methanamine;hydrochloride.
| Compound Name | N-[(5-bromo-2-ethoxyphenyl)methyl]-1-(4-fluorophenyl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 2983714 |
| Molecular Formula | C16H18BrClFNO |
| Molecular Weight | 374.68 g/mol |
| Exact Mass | 373.02 |
| IUPAC Name | N-[(5-bromo-2-ethoxyphenyl)methyl]-1-(4-fluorophenyl)methanamine;hydrochloride |
| SMILES | CCOc1ccc(Br)cc1CNCc1ccc(F)cc1.Cl |
| InChI | InChI=1S/C16H17BrFNO.ClH/c1-2-20-16-8-5-14(17)9-13(16)11-19-10-12-3-6-15(18)7-4-12;/h3-9,19H,2,10-11H2,1H3;1H |
| InChIKey | YDRWQVQDUKHZEW-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.68 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |