C11H17BrClNO — CID 17292192
N-[(5-bromo-2-ethoxyphenyl)methyl]ethanamine;hydrochloride (PubChem CID 17292192) has the molecular formula C11H17BrClNO and a molecular weight of 294.62 g/mol. Its IUPAC name is N-[(5-bromo-2-ethoxyphenyl)methyl]ethanamine;hydrochloride.
| Compound Name | N-[(5-bromo-2-ethoxyphenyl)methyl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 17292192 |
| Molecular Formula | C11H17BrClNO |
| Molecular Weight | 294.62 g/mol |
| Exact Mass | 293.02 |
| IUPAC Name | N-[(5-bromo-2-ethoxyphenyl)methyl]ethanamine;hydrochloride |
| SMILES | CCNCc1cc(Br)ccc1OCC.Cl |
| InChI | InChI=1S/C11H16BrNO.ClH/c1-3-13-8-9-7-10(12)5-6-11(9)14-4-2;/h5-7,13H,3-4,8H2,1-2H3;1H |
| InChIKey | IHSQRWICIBNZTO-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.62 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |