C18H22FNO2 — CID 54803870
N-[(2,4-diethoxyphenyl)methyl]-1-(4-fluorophenyl)methanamine (PubChem CID 54803870) has the molecular formula C18H22FNO2 and a molecular weight of 303.38 g/mol. Its IUPAC name is N-[(2,4-diethoxyphenyl)methyl]-1-(4-fluorophenyl)methanamine.
| Compound Name | N-[(2,4-diethoxyphenyl)methyl]-1-(4-fluorophenyl)methanamine |
|---|---|
| PubChem CID | 54803870 |
| Molecular Formula | C18H22FNO2 |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | N-[(2,4-diethoxyphenyl)methyl]-1-(4-fluorophenyl)methanamine |
| SMILES | CCOc1ccc(CNCc2ccc(F)cc2)c(OCC)c1 |
| InChI | InChI=1S/C18H22FNO2/c1-3-21-17-10-7-15(18(11-17)22-4-2)13-20-12-14-5-8-16(19)9-6-14/h5-11,20H,3-4,12-13H2,1-2H3 |
| InChIKey | AXPYIKJYZYGAGW-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |