C18H22BrFN2O2 — CID 4720668
2-[2-[[5-bromo-2-[(4-fluorophenyl)methoxy]phenyl]methylamino]ethylamino]ethanol (PubChem CID 4720668) has the molecular formula C18H22BrFN2O2 and a molecular weight of 397.29 g/mol. Its IUPAC name is 2-[2-[[5-bromo-2-[(4-fluorophenyl)methoxy]phenyl]methylamino]ethylamino]ethanol.
| Compound Name | 2-[2-[[5-bromo-2-[(4-fluorophenyl)methoxy]phenyl]methylamino]ethylamino]ethanol |
|---|---|
| PubChem CID | 4720668 |
| Molecular Formula | C18H22BrFN2O2 |
| Molecular Weight | 397.29 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 2-[2-[[5-bromo-2-[(4-fluorophenyl)methoxy]phenyl]methylamino]ethylamino]ethanol |
| SMILES | OCCNCCNCc1cc(Br)ccc1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C18H22BrFN2O2/c19-16-3-6-18(24-13-14-1-4-17(20)5-2-14)15(11-16)12-22-8-7-21-9-10-23/h1-6,11,21-23H,7-10,12-13H2 |
| InChIKey | XGPBSIXLEHIJJZ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.29 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|