C17H16BrF4NO2 — CID 135397656
2-[[5-bromo-2-[[4-fluoro-3-(trifluoromethyl)phenyl]methoxy]phenyl]methylamino]ethanol (PubChem CID 135397656) has the molecular formula C17H16BrF4NO2 and a molecular weight of 422.22 g/mol. Its IUPAC name is 2-[[5-bromo-2-[[4-fluoro-3-(trifluoromethyl)phenyl]methoxy]phenyl]methylamino]ethanol.
| Compound Name | 2-[[5-bromo-2-[[4-fluoro-3-(trifluoromethyl)phenyl]methoxy]phenyl]methylamino]ethanol |
|---|---|
| PubChem CID | 135397656 |
| Molecular Formula | C17H16BrF4NO2 |
| Molecular Weight | 422.22 g/mol |
| Exact Mass | 421.03 |
| IUPAC Name | 2-[[5-bromo-2-[[4-fluoro-3-(trifluoromethyl)phenyl]methoxy]phenyl]methylamino]ethanol |
| SMILES | OCCNCc1cc(Br)ccc1OCc1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H16BrF4NO2/c18-13-2-4-16(12(8-13)9-23-5-6-24)25-10-11-1-3-15(19)14(7-11)17(20,21)22/h1-4,7-8,23-24H,5-6,9-10H2 |
| InChIKey | ITHSFXDGKQYOED-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.22 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|