C22H23F4NO3 — CID 170007205
2-[[2-[[4-fluoro-3-(trifluoromethyl)phenyl]methoxy]-5-pent-3-ynoxyphenyl]methylamino]ethanol (PubChem CID 170007205) has the molecular formula C22H23F4NO3 and a molecular weight of 425.42 g/mol. Its IUPAC name is 2-[[2-[[4-fluoro-3-(trifluoromethyl)phenyl]methoxy]-5-pent-3-ynoxyphenyl]methylamino]ethanol.
| Compound Name | 2-[[2-[[4-fluoro-3-(trifluoromethyl)phenyl]methoxy]-5-pent-3-ynoxyphenyl]methylamino]ethanol |
|---|---|
| PubChem CID | 170007205 |
| Molecular Formula | C22H23F4NO3 |
| Molecular Weight | 425.42 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | 2-[[2-[[4-fluoro-3-(trifluoromethyl)phenyl]methoxy]-5-pent-3-ynoxyphenyl]methylamino]ethanol |
| SMILES | CC#CCCOc1ccc(OCc2ccc(F)c(C(F)(F)F)c2)c(CNCCO)c1 |
| InChI | InChI=1S/C22H23F4NO3/c1-2-3-4-11-29-18-6-8-21(17(13-18)14-27-9-10-28)30-15-16-5-7-20(23)19(12-16)22(24,25)26/h5-8,12-13,27-28H,4,9-11,14-15H2,1H3 |
| InChIKey | PNFYSOUHNNUWCW-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.42 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|