C19H20BrF4NO2 — CID 168959542
5-[5-bromo-2-[[4-fluoro-3-(trifluoromethyl)phenyl]methoxy]anilino]pentan-1-ol (PubChem CID 168959542) has the molecular formula C19H20BrF4NO2 and a molecular weight of 450.27 g/mol. Its IUPAC name is 5-[5-bromo-2-[[4-fluoro-3-(trifluoromethyl)phenyl]methoxy]anilino]pentan-1-ol.
| Compound Name | 5-[5-bromo-2-[[4-fluoro-3-(trifluoromethyl)phenyl]methoxy]anilino]pentan-1-ol |
|---|---|
| PubChem CID | 168959542 |
| Molecular Formula | C19H20BrF4NO2 |
| Molecular Weight | 450.27 g/mol |
| Exact Mass | 449.06 |
| IUPAC Name | 5-[5-bromo-2-[[4-fluoro-3-(trifluoromethyl)phenyl]methoxy]anilino]pentan-1-ol |
| SMILES | OCCCCCNc1cc(Br)ccc1OCc1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H20BrF4NO2/c20-14-5-7-18(17(11-14)25-8-2-1-3-9-26)27-12-13-4-6-16(21)15(10-13)19(22,23)24/h4-7,10-11,25-26H,1-3,8-9,12H2 |
| InChIKey | YJMABUQZQDQXHB-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.27 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|