C12H12BrF6N — CID 107286470
5-bromo-2-(trifluoromethyl)-N-(5,5,5-trifluoropentyl)aniline (PubChem CID 107286470) has the molecular formula C12H12BrF6N and a molecular weight of 364.13 g/mol. Its IUPAC name is 5-bromo-2-(trifluoromethyl)-N-(5,5,5-trifluoropentyl)aniline.
| Compound Name | 5-bromo-2-(trifluoromethyl)-N-(5,5,5-trifluoropentyl)aniline |
|---|---|
| PubChem CID | 107286470 |
| Molecular Formula | C12H12BrF6N |
| Molecular Weight | 364.13 g/mol |
| Exact Mass | 363.01 |
| IUPAC Name | 5-bromo-2-(trifluoromethyl)-N-(5,5,5-trifluoropentyl)aniline |
| SMILES | FC(F)(F)CCCCNc1cc(Br)ccc1C(F)(F)F |
| InChI | InChI=1S/C12H12BrF6N/c13-8-3-4-9(12(17,18)19)10(7-8)20-6-2-1-5-11(14,15)16/h3-4,7,20H,1-2,5-6H2 |
| InChIKey | NVVUZPBKGLILNQ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.13 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|