C14H19BrF3N3 — CID 107286817
5-bromo-N-(3-piperazin-1-ylpropyl)-2-(trifluoromethyl)aniline (PubChem CID 107286817) has the molecular formula C14H19BrF3N3 and a molecular weight of 366.23 g/mol. Its IUPAC name is 5-bromo-N-(3-piperazin-1-ylpropyl)-2-(trifluoromethyl)aniline.
| Compound Name | 5-bromo-N-(3-piperazin-1-ylpropyl)-2-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 107286817 |
| Molecular Formula | C14H19BrF3N3 |
| Molecular Weight | 366.23 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | 5-bromo-N-(3-piperazin-1-ylpropyl)-2-(trifluoromethyl)aniline |
| SMILES | FC(F)(F)c1ccc(Br)cc1NCCCN1CCNCC1 |
| InChI | InChI=1S/C14H19BrF3N3/c15-11-2-3-12(14(16,17)18)13(10-11)20-4-1-7-21-8-5-19-6-9-21/h2-3,10,19-20H,1,4-9H2 |
| InChIKey | WFFUDGSGQVNTPH-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.23 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|