C14H18BrF3N2 — CID 107286988
5-bromo-N-[(4-methylpiperidin-4-yl)methyl]-2-(trifluoromethyl)aniline (PubChem CID 107286988) has the molecular formula C14H18BrF3N2 and a molecular weight of 351.21 g/mol. Its IUPAC name is 5-bromo-N-[(4-methylpiperidin-4-yl)methyl]-2-(trifluoromethyl)aniline.
| Compound Name | 5-bromo-N-[(4-methylpiperidin-4-yl)methyl]-2-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 107286988 |
| Molecular Formula | C14H18BrF3N2 |
| Molecular Weight | 351.21 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | 5-bromo-N-[(4-methylpiperidin-4-yl)methyl]-2-(trifluoromethyl)aniline |
| SMILES | CC1(CNc2cc(Br)ccc2C(F)(F)F)CCNCC1 |
| InChI | InChI=1S/C14H18BrF3N2/c1-13(4-6-19-7-5-13)9-20-12-8-10(15)2-3-11(12)14(16,17)18/h2-3,8,19-20H,4-7,9H2,1H3 |
| InChIKey | ICBUBKABPKMRHX-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.21 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |