C14H17BrF3N — CID 107414090
5-bromo-N-[(3-methylcyclopentyl)methyl]-2-(trifluoromethyl)aniline (PubChem CID 107414090) has the molecular formula C14H17BrF3N and a molecular weight of 336.20 g/mol. Its IUPAC name is 5-bromo-N-[(3-methylcyclopentyl)methyl]-2-(trifluoromethyl)aniline.
| Compound Name | 5-bromo-N-[(3-methylcyclopentyl)methyl]-2-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 107414090 |
| Molecular Formula | C14H17BrF3N |
| Molecular Weight | 336.20 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | 5-bromo-N-[(3-methylcyclopentyl)methyl]-2-(trifluoromethyl)aniline |
| SMILES | CC1CCC(CNc2cc(Br)ccc2C(F)(F)F)C1 |
| InChI | InChI=1S/C14H17BrF3N/c1-9-2-3-10(6-9)8-19-13-7-11(15)4-5-12(13)14(16,17)18/h4-5,7,9-10,19H,2-3,6,8H2,1H3 |
| InChIKey | DGOKBCHHDPABPL-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.20 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |