C12H13BrF3NO — CID 107286259
2-[5-bromo-2-(trifluoromethyl)anilino]-1-cyclopropylethanol (PubChem CID 107286259) has the molecular formula C12H13BrF3NO and a molecular weight of 324.14 g/mol. Its IUPAC name is 2-[5-bromo-2-(trifluoromethyl)anilino]-1-cyclopropylethanol.
| Compound Name | 2-[5-bromo-2-(trifluoromethyl)anilino]-1-cyclopropylethanol |
|---|---|
| PubChem CID | 107286259 |
| Molecular Formula | C12H13BrF3NO |
| Molecular Weight | 324.14 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | 2-[5-bromo-2-(trifluoromethyl)anilino]-1-cyclopropylethanol |
| SMILES | OC(CNc1cc(Br)ccc1C(F)(F)F)C1CC1 |
| InChI | InChI=1S/C12H13BrF3NO/c13-8-3-4-9(12(14,15)16)10(5-8)17-6-11(18)7-1-2-7/h3-5,7,11,17-18H,1-2,6H2 |
| InChIKey | NJUROHVPLGYUON-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.14 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |