C10H10BrF3N2O2 — CID 106171079
3-[5-bromo-2-(trifluoromethyl)anilino]-2-hydroxypropanamide (PubChem CID 106171079) has the molecular formula C10H10BrF3N2O2 and a molecular weight of 327.10 g/mol. Its IUPAC name is 3-[5-bromo-2-(trifluoromethyl)anilino]-2-hydroxypropanamide.
| Compound Name | 3-[5-bromo-2-(trifluoromethyl)anilino]-2-hydroxypropanamide |
|---|---|
| PubChem CID | 106171079 |
| Molecular Formula | C10H10BrF3N2O2 |
| Molecular Weight | 327.10 g/mol |
| Exact Mass | 325.99 |
| IUPAC Name | 3-[5-bromo-2-(trifluoromethyl)anilino]-2-hydroxypropanamide |
| SMILES | NC(=O)C(O)CNc1cc(Br)ccc1C(F)(F)F |
| InChI | InChI=1S/C10H10BrF3N2O2/c11-5-1-2-6(10(12,13)14)7(3-5)16-4-8(17)9(15)18/h1-3,8,16-17H,4H2,(H2,15,18) |
| InChIKey | UZMNREUTDLMUJB-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.10 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |