C10H12F3N3O2 — CID 114152829
3-[4-amino-2-(trifluoromethyl)anilino]-2-hydroxypropanamide (PubChem CID 114152829) has the molecular formula C10H12F3N3O2 and a molecular weight of 263.22 g/mol. Its IUPAC name is 3-[4-amino-2-(trifluoromethyl)anilino]-2-hydroxypropanamide.
| Compound Name | 3-[4-amino-2-(trifluoromethyl)anilino]-2-hydroxypropanamide |
|---|---|
| PubChem CID | 114152829 |
| Molecular Formula | C10H12F3N3O2 |
| Molecular Weight | 263.22 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 3-[4-amino-2-(trifluoromethyl)anilino]-2-hydroxypropanamide |
| SMILES | NC(=O)C(O)CNc1ccc(N)cc1C(F)(F)F |
| InChI | InChI=1S/C10H12F3N3O2/c11-10(12,13)6-3-5(14)1-2-7(6)16-4-8(17)9(15)18/h1-3,8,16-17H,4,14H2,(H2,15,18) |
| InChIKey | MEBVEFQLVLHRTG-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.22 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|