C11H12BrF3N2O — CID 60790963
3-[4-bromo-2-(trifluoromethyl)anilino]-2-methylpropanamide (PubChem CID 60790963) has the molecular formula C11H12BrF3N2O and a molecular weight of 325.13 g/mol. Its IUPAC name is 3-[4-bromo-2-(trifluoromethyl)anilino]-2-methylpropanamide.
| Compound Name | 3-[4-bromo-2-(trifluoromethyl)anilino]-2-methylpropanamide |
|---|---|
| PubChem CID | 60790963 |
| Molecular Formula | C11H12BrF3N2O |
| Molecular Weight | 325.13 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | 3-[4-bromo-2-(trifluoromethyl)anilino]-2-methylpropanamide |
| SMILES | CC(CNc1ccc(Br)cc1C(F)(F)F)C(N)=O |
| InChI | InChI=1S/C11H12BrF3N2O/c1-6(10(16)18)5-17-9-3-2-7(12)4-8(9)11(13,14)15/h2-4,6,17H,5H2,1H3,(H2,16,18) |
| InChIKey | XFSPTEBIZLEVBB-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.13 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |