C14H19BrF3NO — CID 107153157
1-[4-bromo-2-(trifluoromethyl)anilino]-4,4-dimethylpentan-2-ol (PubChem CID 107153157) has the molecular formula C14H19BrF3NO and a molecular weight of 354.21 g/mol. Its IUPAC name is 1-[4-bromo-2-(trifluoromethyl)anilino]-4,4-dimethylpentan-2-ol.
| Compound Name | 1-[4-bromo-2-(trifluoromethyl)anilino]-4,4-dimethylpentan-2-ol |
|---|---|
| PubChem CID | 107153157 |
| Molecular Formula | C14H19BrF3NO |
| Molecular Weight | 354.21 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | 1-[4-bromo-2-(trifluoromethyl)anilino]-4,4-dimethylpentan-2-ol |
| SMILES | CC(C)(C)CC(O)CNc1ccc(Br)cc1C(F)(F)F |
| InChI | InChI=1S/C14H19BrF3NO/c1-13(2,3)7-10(20)8-19-12-5-4-9(15)6-11(12)14(16,17)18/h4-6,10,19-20H,7-8H2,1-3H3 |
| InChIKey | SOZNXZJLXYFZOC-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.21 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |