C14H19BrF3NO — CID 106115734
3-[[4-bromo-2-(trifluoromethyl)anilino]methyl]hexan-1-ol (PubChem CID 106115734) has the molecular formula C14H19BrF3NO and a molecular weight of 354.21 g/mol. Its IUPAC name is 3-[[4-bromo-2-(trifluoromethyl)anilino]methyl]hexan-1-ol.
| Compound Name | 3-[[4-bromo-2-(trifluoromethyl)anilino]methyl]hexan-1-ol |
|---|---|
| PubChem CID | 106115734 |
| Molecular Formula | C14H19BrF3NO |
| Molecular Weight | 354.21 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | 3-[[4-bromo-2-(trifluoromethyl)anilino]methyl]hexan-1-ol |
| SMILES | CCCC(CCO)CNc1ccc(Br)cc1C(F)(F)F |
| InChI | InChI=1S/C14H19BrF3NO/c1-2-3-10(6-7-20)9-19-13-5-4-11(15)8-12(13)14(16,17)18/h4-5,8,10,19-20H,2-3,6-7,9H2,1H3 |
| InChIKey | MMKHJHVPFVXORS-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.21 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |