C10H13F3N2O — CID 92979789
(2R)-1-[4-amino-2-(trifluoromethyl)anilino]propan-2-ol (PubChem CID 92979789) has the molecular formula C10H13F3N2O and a molecular weight of 234.22 g/mol. Its IUPAC name is (2R)-1-[4-amino-2-(trifluoromethyl)anilino]propan-2-ol.
| Compound Name | (2R)-1-[4-amino-2-(trifluoromethyl)anilino]propan-2-ol |
|---|---|
| PubChem CID | 92979789 |
| Molecular Formula | C10H13F3N2O |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | (2R)-1-[4-amino-2-(trifluoromethyl)anilino]propan-2-ol |
| SMILES | C[C@@H](O)CNc1ccc(N)cc1C(F)(F)F |
| InChI | InChI=1S/C10H13F3N2O/c1-6(16)5-15-9-3-2-7(14)4-8(9)10(11,12)13/h2-4,6,15-16H,5,14H2,1H3/t6-/m1/s1 |
| InChIKey | VJYXTWWXBGIBJT-ZCFIWIBFSA-N |
| XLogP | 2.08 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|