C12H17F3N2S — CID 113478588
1-N-(2-methyl-2-methylsulfanylpropyl)-2-(trifluoromethyl)benzene-1,4-diamine (PubChem CID 113478588) has the molecular formula C12H17F3N2S and a molecular weight of 278.34 g/mol. Its IUPAC name is 1-N-(2-methyl-2-methylsulfanylpropyl)-2-(trifluoromethyl)benzene-1,4-diamine.
| Compound Name | 1-N-(2-methyl-2-methylsulfanylpropyl)-2-(trifluoromethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 113478588 |
| Molecular Formula | C12H17F3N2S |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 1-N-(2-methyl-2-methylsulfanylpropyl)-2-(trifluoromethyl)benzene-1,4-diamine |
| SMILES | CSC(C)(C)CNc1ccc(N)cc1C(F)(F)F |
| InChI | InChI=1S/C12H17F3N2S/c1-11(2,18-3)7-17-10-5-4-8(16)6-9(10)12(13,14)15/h4-6,17H,7,16H2,1-3H3 |
| InChIKey | WOQHDQWMDSPMTD-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|