C12H14BrF3N2O — CID 106097201
3-[5-bromo-2-(trifluoromethyl)anilino]-3-methylbutanamide (PubChem CID 106097201) has the molecular formula C12H14BrF3N2O and a molecular weight of 339.16 g/mol. Its IUPAC name is 3-[5-bromo-2-(trifluoromethyl)anilino]-3-methylbutanamide.
| Compound Name | 3-[5-bromo-2-(trifluoromethyl)anilino]-3-methylbutanamide |
|---|---|
| PubChem CID | 106097201 |
| Molecular Formula | C12H14BrF3N2O |
| Molecular Weight | 339.16 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | 3-[5-bromo-2-(trifluoromethyl)anilino]-3-methylbutanamide |
| SMILES | CC(C)(CC(N)=O)Nc1cc(Br)ccc1C(F)(F)F |
| InChI | InChI=1S/C12H14BrF3N2O/c1-11(2,6-10(17)19)18-9-5-7(13)3-4-8(9)12(14,15)16/h3-5,18H,6H2,1-2H3,(H2,17,19) |
| InChIKey | OXXOVJNIEZYZKJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.16 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |