C13H19F3N4 — CID 43443470
N-(3-piperazin-1-ylpropyl)-3-(trifluoromethyl)pyridin-2-amine (PubChem CID 43443470) has the molecular formula C13H19F3N4 and a molecular weight of 288.32 g/mol. Its IUPAC name is N-(3-piperazin-1-ylpropyl)-3-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-(3-piperazin-1-ylpropyl)-3-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 43443470 |
| Molecular Formula | C13H19F3N4 |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | N-(3-piperazin-1-ylpropyl)-3-(trifluoromethyl)pyridin-2-amine |
| SMILES | FC(F)(F)c1cccnc1NCCCN1CCNCC1 |
| InChI | InChI=1S/C13H19F3N4/c14-13(15,16)11-3-1-4-18-12(11)19-5-2-8-20-9-6-17-7-10-20/h1,3-4,17H,2,5-10H2,(H,18,19) |
| InChIKey | TXOJCMZQNAKYLO-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 40.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|