C14H17F3N4 — CID 78863268
N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-(trifluoromethyl)pyridin-2-amine (PubChem CID 78863268) has the molecular formula C14H17F3N4 and a molecular weight of 298.31 g/mol. Its IUPAC name is N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 78863268 |
| Molecular Formula | C14H17F3N4 |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-(trifluoromethyl)pyridin-2-amine |
| SMILES | Cc1cc(C)n(CCCNc2ncccc2C(F)(F)F)n1 |
| InChI | InChI=1S/C14H17F3N4/c1-10-9-11(2)21(20-10)8-4-7-19-13-12(14(15,16)17)5-3-6-18-13/h3,5-6,9H,4,7-8H2,1-2H3,(H,18,19) |
| InChIKey | YJPJIFSHUPMVOT-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|