C13H18N6S — CID 114536969
3-[3-(3,5-dimethylpyrazol-1-yl)propylamino]pyrazine-2-carbothioamide (PubChem CID 114536969) has the molecular formula C13H18N6S and a molecular weight of 290.40 g/mol. Its IUPAC name is 3-[3-(3,5-dimethylpyrazol-1-yl)propylamino]pyrazine-2-carbothioamide.
| Compound Name | 3-[3-(3,5-dimethylpyrazol-1-yl)propylamino]pyrazine-2-carbothioamide |
|---|---|
| PubChem CID | 114536969 |
| Molecular Formula | C13H18N6S |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 3-[3-(3,5-dimethylpyrazol-1-yl)propylamino]pyrazine-2-carbothioamide |
| SMILES | Cc1cc(C)n(CCCNc2nccnc2C(N)=S)n1 |
| InChI | InChI=1S/C13H18N6S/c1-9-8-10(2)19(18-9)7-3-4-16-13-11(12(14)20)15-5-6-17-13/h5-6,8H,3-4,7H2,1-2H3,(H2,14,20)(H,16,17) |
| InChIKey | XISJWQPVTQBQCF-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|