C14H20N6O — CID 114536234
5-amino-2-[3-(3,5-dimethylpyrazol-1-yl)propylamino]pyridine-3-carboxamide (PubChem CID 114536234) has the molecular formula C14H20N6O and a molecular weight of 288.36 g/mol. Its IUPAC name is 5-amino-2-[3-(3,5-dimethylpyrazol-1-yl)propylamino]pyridine-3-carboxamide.
| Compound Name | 5-amino-2-[3-(3,5-dimethylpyrazol-1-yl)propylamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 114536234 |
| Molecular Formula | C14H20N6O |
| Molecular Weight | 288.36 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | 5-amino-2-[3-(3,5-dimethylpyrazol-1-yl)propylamino]pyridine-3-carboxamide |
| SMILES | Cc1cc(C)n(CCCNc2ncc(N)cc2C(N)=O)n1 |
| InChI | InChI=1S/C14H20N6O/c1-9-6-10(2)20(19-9)5-3-4-17-14-12(13(16)21)7-11(15)8-18-14/h6-8H,3-5,15H2,1-2H3,(H2,16,21)(H,17,18) |
| InChIKey | BOJXZZIIZXACFO-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 111.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.36 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|