C8H12N4O — CID 61357419
5-amino-2-(ethylamino)pyridine-3-carboxamide (PubChem CID 61357419) has the molecular formula C8H12N4O and a molecular weight of 180.21 g/mol. Its IUPAC name is 5-amino-2-(ethylamino)pyridine-3-carboxamide.
| Compound Name | 5-amino-2-(ethylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 61357419 |
| Molecular Formula | C8H12N4O |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | 5-amino-2-(ethylamino)pyridine-3-carboxamide |
| SMILES | CCNc1ncc(N)cc1C(N)=O |
| InChI | InChI=1S/C8H12N4O/c1-2-11-8-6(7(10)13)3-5(9)4-12-8/h3-4H,2,9H2,1H3,(H2,10,13)(H,11,12) |
| InChIKey | CNUJFTYPEYELSF-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |