C9H13N5O3 — CID 106166474
5-amino-2-[(3-amino-2-hydroxy-3-oxopropyl)amino]pyridine-3-carboxamide (PubChem CID 106166474) has the molecular formula C9H13N5O3 and a molecular weight of 239.24 g/mol. Its IUPAC name is 5-amino-2-[(3-amino-2-hydroxy-3-oxopropyl)amino]pyridine-3-carboxamide.
| Compound Name | 5-amino-2-[(3-amino-2-hydroxy-3-oxopropyl)amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 106166474 |
| Molecular Formula | C9H13N5O3 |
| Molecular Weight | 239.24 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | 5-amino-2-[(3-amino-2-hydroxy-3-oxopropyl)amino]pyridine-3-carboxamide |
| SMILES | NC(=O)c1cc(N)cnc1NCC(O)C(N)=O |
| InChI | InChI=1S/C9H13N5O3/c10-4-1-5(7(11)16)9(13-2-4)14-3-6(15)8(12)17/h1-2,6,15H,3,10H2,(H2,11,16)(H2,12,17)(H,13,14) |
| InChIKey | KGASDJLNNMLYFP-UHFFFAOYSA-N |
| XLogP | -1.98 |
| TPSA | 157.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.24 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |