About 2-amino-5-[3-(3,5-dimethylpyrazol-1-yl)propylamino]benzamide
2-amino-5-[3-(3,5-dimethylpyrazol-1-yl)propylamino]benzamide (PubChem CID 114539587) has the molecular formula C15H21N5O
and a molecular weight of 287.37 g/mol. Its IUPAC name is 2-amino-5-[3-(3,5-dimethylpyrazol-1-yl)propylamino]benzamide.
Molecular Properties
| Compound Name | 2-amino-5-[3-(3,5-dimethylpyrazol-1-yl)propylamino]benzamide |
| PubChem CID | 114539587 |
| Molecular Formula | C15H21N5O |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 2-amino-5-[3-(3,5-dimethylpyrazol-1-yl)propylamino]benzamide |
| SMILES | Cc1cc(C)n(CCCNc2ccc(N)c(C(N)=O)c2)n1 |
| InChI | InChI=1S/C15H21N5O/c1-10-8-11(2)20(19-10)7-3-6-18-12-4-5-14(16)13(9-12)15(17)21/h4-5,8-9,18H,3,6-7,16H2,1-2H3,(H2,17,21) |
| InChIKey | BWTAXVQFPHYJCZ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 98.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-5-[3-(3,5-dimethylpyrazol-1-yl)propylamino]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-5-[3-(3,5-dimethylpyrazol-1-yl)propylamino]benzamide?
The IUPAC name of 2-amino-5-[3-(3,5-dimethylpyrazol-1-yl)propylamino]benzamide (CID 114539587) is 2-amino-5-[3-(3,5-dimethylpyrazol-1-yl)propylamino]benzamide.
What is the SMILES notation for 2-amino-5-[3-(3,5-dimethylpyrazol-1-yl)propylamino]benzamide?
The canonical SMILES for 2-amino-5-[3-(3,5-dimethylpyrazol-1-yl)propylamino]benzamide is Cc1cc(C)n(CCCNc2ccc(N)c(C(N)=O)c2)n1.
What is the InChIKey of 2-amino-5-[3-(3,5-dimethylpyrazol-1-yl)propylamino]benzamide?
The InChIKey is BWTAXVQFPHYJCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N5O/c1-10-8-11(2)20(19-10)7-3-6-18-12-4-5-14(16)13(9-12)15(17)21/h4-5,8-9,18H,3,6-7,16H2,1-2H3,(H2,17,21).
What are the key properties of 2-amino-5-[3-(3,5-dimethylpyrazol-1-yl)propylamino]benzamide?
2-amino-5-[3-(3,5-dimethylpyrazol-1-yl)propylamino]benzamide has a molecular weight of 287.37 g/mol, XLogP of 1.68, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5-[3-(3,5-dimethylpyrazol-1-yl)propylamino]benzamide is sourced from PubChem (CID 114539587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).