C13H20N6 — CID 114536169
6-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]pyridine-2,3,6-triamine (PubChem CID 114536169) has the molecular formula C13H20N6 and a molecular weight of 260.35 g/mol. Its IUPAC name is 6-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]pyridine-2,3,6-triamine.
| Compound Name | 6-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]pyridine-2,3,6-triamine |
|---|---|
| PubChem CID | 114536169 |
| Molecular Formula | C13H20N6 |
| Molecular Weight | 260.35 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | 6-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]pyridine-2,3,6-triamine |
| SMILES | Cc1cc(C)n(CCCNc2ccc(N)c(N)n2)n1 |
| InChI | InChI=1S/C13H20N6/c1-9-8-10(2)19(18-9)7-3-6-16-12-5-4-11(14)13(15)17-12/h4-5,8H,3,6-7,14H2,1-2H3,(H3,15,16,17) |
| InChIKey | JJVAKBZYVMOFPQ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 94.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.35 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|