C20H31N9 — CID 86816276
2-N,4-N-bis[3-(3,5-dimethylpyrazol-1-yl)propyl]-6-methyl-1,3,5-triazine-2,4-diamine (PubChem CID 86816276) has the molecular formula C20H31N9 and a molecular weight of 397.53 g/mol. Its IUPAC name is 2-N,4-N-bis[3-(3,5-dimethylpyrazol-1-yl)propyl]-6-methyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,4-N-bis[3-(3,5-dimethylpyrazol-1-yl)propyl]-6-methyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 86816276 |
| Molecular Formula | C20H31N9 |
| Molecular Weight | 397.53 g/mol |
| Exact Mass | 397.27 |
| IUPAC Name | 2-N,4-N-bis[3-(3,5-dimethylpyrazol-1-yl)propyl]-6-methyl-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1cc(C)n(CCCNc2nc(C)nc(NCCCn3nc(C)cc3C)n2)n1 |
| InChI | InChI=1S/C20H31N9/c1-14-12-16(3)28(26-14)10-6-8-21-19-23-18(5)24-20(25-19)22-9-7-11-29-17(4)13-15(2)27-29/h12-13H,6-11H2,1-5H3,(H2,21,22,23,24,25) |
| InChIKey | VBROCIVZPOJTDE-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 98.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.53 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|