C14H19Cl2N5 — CID 102760138
3,5-dichloro-6-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-N-methylpyridine-2,6-diamine (PubChem CID 102760138) has the molecular formula C14H19Cl2N5 and a molecular weight of 328.25 g/mol. Its IUPAC name is 3,5-dichloro-6-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-N-methylpyridine-2,6-diamine.
| Compound Name | 3,5-dichloro-6-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-N-methylpyridine-2,6-diamine |
|---|---|
| PubChem CID | 102760138 |
| Molecular Formula | C14H19Cl2N5 |
| Molecular Weight | 328.25 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 3,5-dichloro-6-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-N-methylpyridine-2,6-diamine |
| SMILES | CNc1nc(NCCCn2nc(C)cc2C)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H19Cl2N5/c1-9-7-10(2)21(20-9)6-4-5-18-14-12(16)8-11(15)13(17-3)19-14/h7-8H,4-6H2,1-3H3,(H2,17,18,19) |
| InChIKey | OBOLDFRPPBTJJW-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 54.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.25 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|