C14H19ClFN5 — CID 103553524
5-chloro-1-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-6-fluorobenzene-1,2,4-triamine (PubChem CID 103553524) has the molecular formula C14H19ClFN5 and a molecular weight of 311.79 g/mol. Its IUPAC name is 5-chloro-1-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-6-fluorobenzene-1,2,4-triamine.
| Compound Name | 5-chloro-1-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-6-fluorobenzene-1,2,4-triamine |
|---|---|
| PubChem CID | 103553524 |
| Molecular Formula | C14H19ClFN5 |
| Molecular Weight | 311.79 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 5-chloro-1-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-6-fluorobenzene-1,2,4-triamine |
| SMILES | Cc1cc(C)n(CCCNc2c(N)cc(N)c(Cl)c2F)n1 |
| InChI | InChI=1S/C14H19ClFN5/c1-8-6-9(2)21(20-8)5-3-4-19-14-11(18)7-10(17)12(15)13(14)16/h6-7,19H,3-5,17-18H2,1-2H3 |
| InChIKey | DSDVNJHMBLKKBU-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 81.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.79 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|